EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O |
| InChI | InChI=1S/C16H12O6/c1-21-13-4-8(2-3-11(13)18)10-7-22-14-6-9(17)5-12(19)15(14)16(10)20/h2-7,17-19H,1H3 |
| InChIKey | ZMFBGWWGXBNJAC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-O-methylorobol (CHEBI:70032) has functional parent orobol (CHEBI:69437) |
| 3'-O-methylorobol (CHEBI:70032) has role plant metabolite (CHEBI:76924) |
| 3'-O-methylorobol (CHEBI:70032) is a hydroxyisoflavone (CHEBI:38755) |
| 3'-O-methylorobol (CHEBI:70032) is a methoxyisoflavone (CHEBI:38756) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 5,7,4'-trihydroxy-3'-methoxyisoflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4264882 | Reaxys |
| Citations |
|---|