EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
| InChIKey | IOYHCQBYQJQBSK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orobol (CHEBI:69437) has functional parent isoflavone (CHEBI:18220) |
| orobol (CHEBI:69437) has role anti-inflammatory agent (CHEBI:67079) |
| orobol (CHEBI:69437) has role fungal metabolite (CHEBI:76946) |
| orobol (CHEBI:69437) has role plant metabolite (CHEBI:76924) |
| orobol (CHEBI:69437) has role radical scavenger (CHEBI:48578) |
| orobol (CHEBI:69437) is a 7-hydroxyisoflavones (CHEBI:55465) |
| Incoming Relation(s) |
| 3'-O-methylorobol (CHEBI:70032) has functional parent orobol (CHEBI:69437) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',4',5,7-tetrahydroxyisoflavone | ChEBI |
| 3'-hydroxygenistein | ChEBI |
| 5,7-dihydroxy-3-(3,4-dihydroxyphenyl)-4-1H-benzopyran-4-one | ChemIDplus |
| isoluteolin | ChemIDplus |
| norsantal | LIPID MAPS |
| santol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002554 | KNApSAcK |
| C10510 | KEGG COMPOUND |
| HMDB0041658 | HMDB |
| LMPK12050251 | LIPID MAPS |
| Orobol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:292790 | Reaxys |
| CAS:480-23-9 | ChemIDplus |
| CAS:480-23-9 | KEGG COMPOUND |
| Citations |
|---|