EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O8 |
| Net Charge | 0 |
| Average Mass | 416.426 |
| Monoisotopic Mass | 416.14712 |
| SMILES | C/C=C/C1=CC2=C(CO1)C(=O)[C@](C)(O)[C@H](OC(=O)c1c(C)cc(O)c(O)c1OC)C2 |
| InChI | InChI=1S/C22H24O8/c1-5-6-13-8-12-9-16(22(3,27)20(25)14(12)10-29-13)30-21(26)17-11(2)7-15(23)18(24)19(17)28-4/h5-8,16,23-24,27H,9-10H2,1-4H3/b6-5+/t16-,22-/m1/s1 |
| InChIKey | VWYGBXGOGQHZHM-JBAXFHHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium commune (ncbitaxon:36653) | mycelium (BTO:0001436) | PubMed (21226488) | Methanolic extract of mycelia and ethyl acetate extract of culture broth Strain: QSD 17 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| comazaphilone E (CHEBI:70014) has role Penicillium metabolite (CHEBI:76964) |
| comazaphilone E (CHEBI:70014) has role antibacterial agent (CHEBI:33282) |
| comazaphilone E (CHEBI:70014) has role antineoplastic agent (CHEBI:35610) |
| comazaphilone E (CHEBI:70014) is a aromatic ether (CHEBI:35618) |
| comazaphilone E (CHEBI:70014) is a azaphilone (CHEBI:50941) |
| comazaphilone E (CHEBI:70014) is a benzoate ester (CHEBI:36054) |
| comazaphilone E (CHEBI:70014) is a catechols (CHEBI:33566) |
| comazaphilone E (CHEBI:70014) is a isochromenes (CHEBI:38761) |
| comazaphilone E (CHEBI:70014) is a tertiary alcohol (CHEBI:26878) |
| comazaphilone E (CHEBI:70014) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| rel-(6R,7R)-7-hydroxy-7-methyl-8-oxo-3-[(1E)-prop-1-en-1-yl]-5,6,7,8-tetrahydro-1H-isochromen-6-yl 3,4-dihydroxy-2-methoxy-6-methylbenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312867 | Reaxys |
| Citations |
|---|