EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O4S |
| Net Charge | 0 |
| Average Mass | 427.526 |
| Monoisotopic Mass | 427.15658 |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CCN1CCOCC1)c1ccccc1S2 |
| InChI | InChI=1S/C22H25N3O4S/c1-2-29-22(27)23-16-7-8-20-18(15-16)25(17-5-3-4-6-19(17)30-20)21(26)9-10-24-11-13-28-14-12-24/h3-8,15H,2,9-14H2,1H3,(H,23,27) |
| InChIKey | FUBVWMNBEHXPSU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moricizine (CHEBI:6997) has role anti-arrhythmia drug (CHEBI:38070) |
| moricizine (CHEBI:6997) is a carbamate ester (CHEBI:23003) |
| moricizine (CHEBI:6997) is a morpholines (CHEBI:38785) |
| moricizine (CHEBI:6997) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| moricizine hydrochloride (CHEBI:60937) has part moricizine (CHEBI:6997) |
| IUPAC Name |
|---|
| ethyl {10-[3-(morpholin-4-yl)propanoyl]-10H-phenothiazin-2-yl}carbamate |
| INNs | Source |
|---|---|
| moracizina | ChemIDplus |
| moracizine | KEGG DRUG |
| moracizinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| [10-(3-Morpholin-4-yl-propionyl)-10H-phenothiazin-2-yl]-carbamic acid ethyl ester | ChEMBL |
| EN-313 | ChEMBL |
| ethyl 10-(3-morpholinopropionyl)phenothiazine-2-carbamate | ChemIDplus |
| ethyl 10-(β-N-morpholinylpropionyl)phenothiazine-2-carbamate | ChEBI |
| Moricizine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:592021 | Reaxys |
| CAS:31883-05-3 | ChemIDplus |
| CAS:31883-05-3 | KEGG COMPOUND |