EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N3O4S.Cl |
| Net Charge | 0 |
| Average Mass | 463.987 |
| Monoisotopic Mass | 463.13325 |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CC[NH+]1CCOCC1)c1ccccc1S2.[Cl-] |
| InChI | InChI=1S/C22H25N3O4S.ClH/c1-2-29-22(27)23-16-7-8-20-18(15-16)25(17-5-3-4-6-19(17)30-20)21(26)9-10-24-11-13-28-14-12-24;/h3-8,15H,2,9-14H2,1H3,(H,23,27);1H |
| InChIKey | GAQAKFHSULJNAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moricizine hydrochloride (CHEBI:60937) has part moricizine (CHEBI:6997) |
| moricizine hydrochloride (CHEBI:60937) has role anti-arrhythmia drug (CHEBI:38070) |
| moricizine hydrochloride (CHEBI:60937) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 4-(3-{2-[(ethoxycarbonyl)amino]-10H-phenothiazin-10-yl}-3-oxopropyl)morpholin-4-ium chloride |
| ethyl {10-[3-(morpholin-4-yl)propanoyl]-10HH-phenothiazin-2-yl}carbamate hydrochloride |
| Synonyms | Source |
|---|---|
| ethyl 10-(β-N-morpholinylpropionyl)phenothiazine-2-carbamate hydrochloride | ChemIDplus |
| moracizine HCl | ChEBI |
| moracizine hydrochloride | ChEBI |
| moricizine HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Ethmozine | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02087 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5212239 | Reaxys |
| CAS:29560-58-5 | KEGG DRUG |
| CAS:29560-58-5 | ChemIDplus |