EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36O7 |
| Net Charge | 0 |
| Average Mass | 544.644 |
| Monoisotopic Mass | 544.24610 |
| SMILES | [H][C@@]12C[C@@]3([H])C=C4C(=O)c5c(O)c6c(c(CC=C(C)C)c5O[C@]41[C@@](C/C=C(/C)C=O)(OC2(C)C)C3=O)OC(C)(C)C=C6 |
| InChI | InChI=1S/C33H36O7/c1-17(2)8-9-21-27-20(11-12-30(4,5)38-27)25(35)24-26(36)22-14-19-15-23-31(6,7)40-32(29(19)37,13-10-18(3)16-34)33(22,23)39-28(21)24/h8,10-12,14,16,19,23,35H,9,13,15H2,1-7H3/b18-10-/t19-,23+,32+,33-/m1/s1 |
| InChIKey | COQAPWLZSHQTKA-MSDOJSJISA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| morellin (CHEBI:6995) has role antineoplastic agent (CHEBI:35610) |
| morellin (CHEBI:6995) is a aldehyde (CHEBI:17478) |
| morellin (CHEBI:6995) is a cyclic ether (CHEBI:37407) |
| morellin (CHEBI:6995) is a cyclic ketone (CHEBI:3992) |
| morellin (CHEBI:6995) is a organic heterohexacyclic compound (CHEBI:51914) |
| morellin (CHEBI:6995) is a phenols (CHEBI:33853) |
| morellin (CHEBI:6995) is a polycyclic cage (CHEBI:33640) |
| Incoming Relation(s) |
| 7-methoxydeoxymorellin (CHEBI:66704) has functional parent morellin (CHEBI:6995) |
| morellic acid (CHEBI:66401) has functional parent morellin (CHEBI:6995) |
| IUPAC Name |
|---|
| (2Z)-4-[(1R,3aS,5S,14aS)-8-hydroxy-3,3,11,11-tetramethyl-13-(3-methylbut-2-en-1-yl)-7,15-dioxo-3a,4,5,7-tetrahydro-3H,11H-1,5-methanofuro[3,4-g]pyrano[3,2-b]xanthen-1-yl]-2-methylbut-2-enal |
| Synonym | Source |
|---|---|
| Morellin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002967 | KNApSAcK |
| C10085 | KEGG COMPOUND |
| HMDB0030794 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11159084 | Reaxys |
| CAS:1183-12-6 | ChemIDplus |
| CAS:1183-12-6 | KEGG COMPOUND |
| Citations |
|---|