EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H40O7 |
| Net Charge | 0 |
| Average Mass | 560.687 |
| Monoisotopic Mass | 560.27740 |
| SMILES | [H][C@@]12C[C@@]3(OC)C=C4C(=O)c5c(O)c6c(c(CC=C(C)C)c5O[C@]41[C@@](CC=C(C)C)(OC2(C)C)C3=O)OC(C)(C)C=C6 |
| InChI | InChI=1S/C34H40O7/c1-18(2)10-11-21-27-20(13-14-30(5,6)39-27)25(35)24-26(36)22-16-32(38-9)17-23-31(7,8)41-33(29(32)37,15-12-19(3)4)34(22,23)40-28(21)24/h10,12-14,16,23,35H,11,15,17H2,1-9H3/t23-,32-,33-,34+/m0/s1 |
| InChIKey | USLTUZOWPRBQKK-CKBKNJJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia hanburyi (ncbitaxon:231906) | |||
| fruit (BTO:0000486) | PubMed (17117343) | ||
| latex (BTO:0000710) | PubMed (17117343) | Previous component: resin; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methoxydeoxymorellin (CHEBI:66704) has functional parent morellin (CHEBI:6995) |
| 7-methoxydeoxymorellin (CHEBI:66704) has role antineoplastic agent (CHEBI:35610) |
| 7-methoxydeoxymorellin (CHEBI:66704) has role metabolite (CHEBI:25212) |
| 7-methoxydeoxymorellin (CHEBI:66704) is a cyclic ether (CHEBI:37407) |
| 7-methoxydeoxymorellin (CHEBI:66704) is a cyclic ketone (CHEBI:3992) |
| 7-methoxydeoxymorellin (CHEBI:66704) is a organic heterohexacyclic compound (CHEBI:51914) |
| 7-methoxydeoxymorellin (CHEBI:66704) is a phenols (CHEBI:33853) |
| 7-methoxydeoxymorellin (CHEBI:66704) is a polycyclic cage (CHEBI:33640) |
| IUPAC Name |
|---|
| (1R,3aS,5R,14aS)-8-hydroxy-5-methoxy-3,3,11,11-tetramethyl-1,13-bis(3-methylbut-2-en-1-yl)-3,3a,4,5-tetrahydro-7H,11H-1,5-methanofuro[3,4-g]pyrano[3,2-b]xanthene-7,15-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11109912 | Reaxys |
| Citations |
|---|