EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O6 |
| Net Charge | 0 |
| Average Mass | 390.476 |
| Monoisotopic Mass | 390.20424 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)CC(CO)=C[C@]1([H])[C@]2(O)[C@H](C)C[C@@]2(OC(C)=O)C(C)(C)[C@@]12[H] |
| InChI | InChI=1S/C22H30O6/c1-11-6-16-20(26,18(11)25)9-14(10-23)7-15-17-19(4,5)21(17,28-13(3)24)8-12(2)22(15,16)27/h6-7,12,15-17,23,26-27H,8-10H2,1-5H3/t12-,15+,16-,17-,20-,21+,22-/m1/s1 |
| InChIKey | BOJKFRKNLSCGHY-HXGSDTCMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia fischeriana (ncbitaxon:1035560) | whole plant (BTO:0001461) | PubMed (21534540) | 90% EtOH extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostratin (CHEBI:69818) has role metabolite (CHEBI:25212) |
| prostratin (CHEBI:69818) is a phorbol ester (CHEBI:37532) |
| Synonym | Source |
|---|---|
| 12-deoxyphorbol-13-acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:60857-08-1 | ChemIDplus |
| Citations |
|---|