EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28Cl2O4 |
| Net Charge | 0 |
| Average Mass | 427.368 |
| Monoisotopic Mass | 426.13646 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]1(Cl)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H28Cl2O4/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,24)17(26)10-20(16,3)22(12,28)18(27)11-23/h6-7,9,12,15-17,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1 |
| InChIKey | QLIIKPVHVRXHRI-CXSFZGCWSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. vasoconstrictor agent Drug used to cause constriction of the blood vessels. anti-allergic agent A drug used to treat allergic reactions. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mometasone (CHEBI:6970) has functional parent Δ1-progesterone (CHEBI:34073) |
| mometasone (CHEBI:6970) has role anti-allergic agent (CHEBI:50857) |
| mometasone (CHEBI:6970) has role anti-inflammatory drug (CHEBI:35472) |
| mometasone (CHEBI:6970) has role dermatologic drug (CHEBI:50177) |
| mometasone (CHEBI:6970) has role vasoconstrictor agent (CHEBI:50514) |
| mometasone (CHEBI:6970) is a 11β-hydroxy steroid (CHEBI:35346) |
| mometasone (CHEBI:6970) is a 17α-hydroxy steroid (CHEBI:35342) |
| mometasone (CHEBI:6970) is a 20-oxo steroid (CHEBI:36885) |
| mometasone (CHEBI:6970) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| mometasone (CHEBI:6970) is a chlorinated steroid (CHEBI:77175) |
| mometasone (CHEBI:6970) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| mometasone furoate (CHEBI:47564) has functional parent mometasone (CHEBI:6970) |
| IUPAC Name |
|---|
| 9,21-dichloro-11β,17-dihydroxy-16α-methylpregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| mometasona | ChemIDplus |
| mometasone | ChemIDplus |
| mometasonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-Mometasone | ChemIDplus |
| Mometasone | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:105102-22-5 | KEGG COMPOUND |
| CAS:105102-22-5 | ChemIDplus |