EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47564 - mometasone furoate
| Formula | C27H30Cl2O6 |
| Net Charge | 0 |
| Average Mass | 521.437 |
| Monoisotopic Mass | 520.14194 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](OC(=O)c3ccco3)(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]1(Cl)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C27H30Cl2O6/c1-15-11-19-18-7-6-16-12-17(30)8-9-24(16,2)26(18,29)21(31)13-25(19,3)27(15,22(32)14-28)35-23(33)20-5-4-10-34-20/h4-5,8-10,12,15,18-19,21,31H,6-7,11,13-14H2,1-3H3/t15-,18+,19+,21+,24+,25+,26+,27+/m1/s1 |
| InChIKey | WOFMFGQZHJDGCX-ZULDAHANSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. anti-inflammatory drug A substance that reduces or suppresses inflammation. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-allergic agent A drug used to treat allergic reactions. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mometasone furoate (CHEBI:47564) has functional parent mometasone (CHEBI:6970) |
| mometasone furoate (CHEBI:47564) has role anti-allergic agent (CHEBI:50857) |
| mometasone furoate (CHEBI:47564) has role anti-anaemic agent (CHEBI:75835) |
| mometasone furoate (CHEBI:47564) has role anti-asthmatic agent (CHEBI:65023) |
| mometasone furoate (CHEBI:47564) has role anti-inflammatory drug (CHEBI:35472) |
| mometasone furoate (CHEBI:47564) has role antineoplastic agent (CHEBI:35610) |
| mometasone furoate (CHEBI:47564) has role antipsoriatic (CHEBI:50748) |
| mometasone furoate (CHEBI:47564) has role antiviral agent (CHEBI:22587) |
| mometasone furoate (CHEBI:47564) has role dermatologic drug (CHEBI:50177) |
| mometasone furoate (CHEBI:47564) has role nasal decongestant (CHEBI:77715) |
| mometasone furoate (CHEBI:47564) is a 11β-hydroxy steroid (CHEBI:35346) |
| mometasone furoate (CHEBI:47564) is a 2-furoate ester (CHEBI:50856) |
| mometasone furoate (CHEBI:47564) is a 20-oxo steroid (CHEBI:36885) |
| mometasone furoate (CHEBI:47564) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| mometasone furoate (CHEBI:47564) is a corticosteroid hormone (CHEBI:36699) |
| mometasone furoate (CHEBI:47564) is a organic molecular entity (CHEBI:50860) |
| mometasone furoate (CHEBI:47564) is a organochlorine compound (CHEBI:36683) |
| mometasone furoate (CHEBI:47564) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| 9,21-dichloro-11β-hydroxy-16α-methyl-3,20-dioxopregna-1,4-dien-17-yl furan-2-carboxylate |
| Synonyms | Source |
|---|---|
| LAS-41002 | ChEMBL |
| LAS41002 | ChEMBL |
| LYR-210 | ChEMBL |
| LYR210 | ChEMBL |
| mometasone 17-furoate | ChEBI |
| MOMETASONE FUROATE | PDBeChem |
| Brand Names | Source |
|---|---|
| Asmanex hfa | ChEMBL |
| Asmanex twisthaler | ChEMBL |
| Elocon | ChEMBL |
| Mometasone furoate component of dulera | ChEMBL |
| Mometasone furoate component of lyr-220 active | ChEMBL |
| Mometasone furoate component of ryaltris | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4340538 | Beilstein |
| CAS:83919-23-7 | ChemIDplus |
| Citations |
|---|