EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO3 |
| Net Charge | 0 |
| Average Mass | 329.440 |
| Monoisotopic Mass | 329.19909 |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CCCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H27NO3/c1-16(2)14-21-20(22)10-8-6-4-3-5-7-9-17-11-12-18-19(13-17)24-15-23-18/h4,6,8,10-13,16H,3,5,7,9,14-15H2,1-2H3,(H,21,22)/b6-4+,10-8+ |
| InChIKey | KXYVTCVLCVPQKR-ONNLMXTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sarmentosum (ncbitaxon:405319) | |||
| inflorescence (BTO:0000628) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| stem (BTO:0001300) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| twig (BTO:0001411) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| leaf (BTO:0000713) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| Piper boehmeriaefolium (ncbitaxon:130389) | whole plant (BTO:0001461) | PubMed (21158422) | Methanolic extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pipercallosine (CHEBI:69685) has functional parent 2-methylpropanamine (CHEBI:15997) |
| pipercallosine (CHEBI:69685) has role apoptosis inducer (CHEBI:68495) |
| pipercallosine (CHEBI:69685) has role metabolite (CHEBI:25212) |
| pipercallosine (CHEBI:69685) has role plant metabolite (CHEBI:76924) |
| pipercallosine (CHEBI:69685) is a alkaloid (CHEBI:22315) |
| pipercallosine (CHEBI:69685) is a benzodioxoles (CHEBI:38298) |
| pipercallosine (CHEBI:69685) is a enamide (CHEBI:51751) |
| pipercallosine (CHEBI:69685) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E,4E)-9-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)nona-2,4-dienamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5596775 | Reaxys |
| Citations |
|---|