EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11N |
| Net Charge | 0 |
| Average Mass | 73.139 |
| Monoisotopic Mass | 73.08915 |
| SMILES | CC(C)CN |
| InChI | InChI=1S/C4H11N/c1-4(2)3-5/h4H,3,5H2,1-2H3 |
| InChIKey | KDSNLYIMUZNERS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylpropanamine (CHEBI:15997) has role plant metabolite (CHEBI:76924) |
| 2-methylpropanamine (CHEBI:15997) is a alkylamines (CHEBI:22331) |
| 2-methylpropanamine (CHEBI:15997) is conjugate base of 2-methylpropanaminium (CHEBI:57601) |
| Incoming Relation(s) |
| N-hydroxy-2-methylpropanamine (CHEBI:131928) has functional parent 2-methylpropanamine (CHEBI:15997) |
| pipercallosidine (CHEBI:69688) has functional parent 2-methylpropanamine (CHEBI:15997) |
| pipercallosine (CHEBI:69685) has functional parent 2-methylpropanamine (CHEBI:15997) |
| β-sanshool (CHEBI:66166) has functional parent 2-methylpropanamine (CHEBI:15997) |
| γ-sanshool (CHEBI:66167) has functional parent 2-methylpropanamine (CHEBI:15997) |
| 2-methylpropanaminium (CHEBI:57601) is conjugate acid of 2-methylpropanamine (CHEBI:15997) |
| IUPAC Name |
|---|
| 2-methylpropanamine |
| Synonyms | Source |
|---|---|
| 2-Methylpropanamine | KEGG COMPOUND |
| 2-Methyl-1-propanamine | KEGG COMPOUND |
| Isobutylamine | KEGG COMPOUND |
| 2-methyl-1-propanamine | ChEBI |
| 3-Methyl-2-propylamine | ChemIDplus |
| Monoisobutylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02787 | KEGG COMPOUND |
| C02787 | KEGG COMPOUND |
| CPD-630 | MetaCyc |
| Isobutylamine | Wikipedia |
| HMDB0034198 | HMDB |
| IBN | PDBeChem |
| Citations |
|---|