EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H48O5 |
| Net Charge | 0 |
| Average Mass | 560.775 |
| Monoisotopic Mass | 560.35017 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCc1ccc2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C36H48O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-36(37)38-24-17-18-29-20-22-32-31(25-29)27-34(41-32)30-21-23-33-35(26-30)40-28-39-33/h9-10,20-23,25-27H,2-8,11-19,24,28H2,1H3/b10-9- |
| InChIKey | GIGIGVBVJACSBJ-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-demethoxyegonol oleate (CHEBI:69549) has functional parent egonol oleate (CHEBI:69548) |
| 7-demethoxyegonol oleate (CHEBI:69549) has parent hydride 1-benzofuran (CHEBI:35260) |
| 7-demethoxyegonol oleate (CHEBI:69549) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| 7-demethoxyegonol oleate (CHEBI:69549) has role plant metabolite (CHEBI:76924) |
| 7-demethoxyegonol oleate (CHEBI:69549) is a 1-benzofurans (CHEBI:38830) |
| 7-demethoxyegonol oleate (CHEBI:69549) is a benzodioxoles (CHEBI:38298) |
| 7-demethoxyegonol oleate (CHEBI:69549) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-1-benzofuran-5-yl]propyl (9Z)-octadec-9-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22007794 | Reaxys |
| Citations |
|---|