EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H48O5 |
| Net Charge | 0 |
| Average Mass | 560.775 |
| Monoisotopic Mass | 560.35017 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCc1ccc2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C36H48O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-36(37)38-24-17-18-29-20-22-32-31(25-29)27-34(41-32)30-21-23-33-35(26-30)40-28-39-33/h9-10,20-23,25-27H,2-8,11-19,24,28H2,1H3/b10-9- |
| InChIKey | GIGIGVBVJACSBJ-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-demethoxyegonol oleate (CHEBI:69549) has functional parent egonol oleate (CHEBI:69548) |
| 7-demethoxyegonol oleate (CHEBI:69549) has parent hydride 1-benzofuran (CHEBI:35260) |
| 7-demethoxyegonol oleate (CHEBI:69549) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| 7-demethoxyegonol oleate (CHEBI:69549) has role plant metabolite (CHEBI:76924) |
| 7-demethoxyegonol oleate (CHEBI:69549) is a 1-benzofurans (CHEBI:38830) |
| 7-demethoxyegonol oleate (CHEBI:69549) is a benzodioxoles (CHEBI:38298) |
| 7-demethoxyegonol oleate (CHEBI:69549) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-1-benzofuran-5-yl]propyl (9Z)-octadec-9-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22007794 | Reaxys |
| Citations |
|---|