EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H50O6 |
| Net Charge | 0 |
| Average Mass | 590.801 |
| Monoisotopic Mass | 590.36074 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCc1cc(OC)c2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C37H50O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-36(38)40-23-18-19-29-24-31-27-33(43-37(31)35(25-29)39-2)30-21-22-32-34(26-30)42-28-41-32/h10-11,21-22,24-27H,3-9,12-20,23,28H2,1-2H3/b11-10- |
| InChIKey | GVZWPCDBHBSBHJ-KHPPLWFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| egonol oleate (CHEBI:69548) has functional parent egonol (CHEBI:69558) |
| egonol oleate (CHEBI:69548) has functional parent oleic acid (CHEBI:16196) |
| egonol oleate (CHEBI:69548) has parent hydride 1-benzofuran (CHEBI:35260) |
| egonol oleate (CHEBI:69548) has role plant metabolite (CHEBI:76924) |
| egonol oleate (CHEBI:69548) is a 1-benzofurans (CHEBI:38830) |
| egonol oleate (CHEBI:69548) is a aromatic ether (CHEBI:35618) |
| egonol oleate (CHEBI:69548) is a benzodioxoles (CHEBI:38298) |
| egonol oleate (CHEBI:69548) is a fatty acid ester (CHEBI:35748) |
| Incoming Relation(s) |
| 7-demethoxyegonol oleate (CHEBI:69549) has functional parent egonol oleate (CHEBI:69548) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]propyl (9Z)-octadec-9-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15889611 | Reaxys |
| Citations |
|---|