EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46O5 |
| Net Charge | 0 |
| Average Mass | 558.759 |
| Monoisotopic Mass | 558.33452 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCc1ccc2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C36H46O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-36(37)38-24-17-18-29-20-22-32-31(25-29)27-34(41-32)30-21-23-33-35(26-30)40-28-39-33/h6-7,9-10,20-23,25-27H,2-5,8,11-19,24,28H2,1H3/b7-6-,10-9- |
| InChIKey | AABHSZUTAUSICN-HZJYTTRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-demethoxyegonol-9(Z),12(Z)linoleate (CHEBI:69547) has functional parent egonol-9(Z),12(Z)linoleate (CHEBI:69546) |
| 7-demethoxyegonol-9(Z),12(Z)linoleate (CHEBI:69547) has functional parent linoleic acid (CHEBI:17351) |
| 7-demethoxyegonol-9(Z),12(Z)linoleate (CHEBI:69547) has parent hydride 1-benzofuran (CHEBI:35260) |
| 7-demethoxyegonol-9(Z),12(Z)linoleate (CHEBI:69547) has role plant metabolite (CHEBI:76924) |
| 7-demethoxyegonol-9(Z),12(Z)linoleate (CHEBI:69547) is a 1-benzofurans (CHEBI:38830) |
| 7-demethoxyegonol-9(Z),12(Z)linoleate (CHEBI:69547) is a benzodioxoles (CHEBI:38298) |
| 7-demethoxyegonol-9(Z),12(Z)linoleate (CHEBI:69547) is a polyunsaturated fatty ester (CHEBI:145039) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-1-benzofuran-5-yl]propyl (9Z,12Z)-octadeca-9,12-dienoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22007795 | Reaxys |
| Citations |
|---|