EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H48O6 |
| Net Charge | 0 |
| Average Mass | 588.785 |
| Monoisotopic Mass | 588.34509 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCc1cc(OC)c2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C37H48O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-36(38)40-23-18-19-29-24-31-27-33(43-37(31)35(25-29)39-2)30-21-22-32-34(26-30)42-28-41-32/h7-8,10-11,21-22,24-27H,3-6,9,12-20,23,28H2,1-2H3/b8-7-,11-10- |
| InChIKey | NHCDDUNWYVJRPS-NQLNTKRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) has functional parent egonol (CHEBI:69558) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) has functional parent linoleic acid (CHEBI:17351) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) has parent hydride 1-benzofuran (CHEBI:35260) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) has role plant metabolite (CHEBI:76924) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) is a 1-benzofurans (CHEBI:38830) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) is a aromatic ether (CHEBI:35618) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) is a benzodioxoles (CHEBI:38298) |
| egonol-9(Z),12(Z)linoleate (CHEBI:69546) is a polyunsaturated fatty ester (CHEBI:145039) |
| Incoming Relation(s) |
| 7-demethoxyegonol-9(Z),12(Z)linoleate (CHEBI:69547) has functional parent egonol-9(Z),12(Z)linoleate (CHEBI:69546) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]propyl (9Z,12Z)-octadeca-9,12-dienoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22007796 | Reaxys |
| Citations |
|---|