EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | C/C=C/C1=CC2=CC(=O)[C@@](C)(OC(=O)c3c(O)cc(O)c(O)c3C)C(=O)[C@@]2(O)[C@@H](O)O1 |
| InChI | InChI=1S/C21H20O10/c1-4-5-11-6-10-7-14(24)20(3,18(27)21(10,29)19(28)30-11)31-17(26)15-9(2)16(25)13(23)8-12(15)22/h4-8,19,22-23,25,28-29H,1-3H3/b5-4+/t19-,20+,21+/m0/s1 |
| InChIKey | PLTDHXZQZPWZBC-QWOQCBQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| purpurquinone B (CHEBI:69470) has role Penicillium metabolite (CHEBI:76964) |
| purpurquinone B (CHEBI:69470) has role antiviral agent (CHEBI:22587) |
| purpurquinone B (CHEBI:69470) is a azaphilone (CHEBI:50941) |
| purpurquinone B (CHEBI:69470) is a benzoate ester (CHEBI:36054) |
| purpurquinone B (CHEBI:69470) is a enone (CHEBI:51689) |
| purpurquinone B (CHEBI:69470) is a isochromenes (CHEBI:38761) |
| purpurquinone B (CHEBI:69470) is a polyketide (CHEBI:26188) |
| purpurquinone B (CHEBI:69470) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (1S,7R,8aS)-1,8a-dihydroxy-7-methyl-6,8-dioxo-3-[(1E)-prop-1-en-1-yl]-6,7,8,8a-tetrahydro-1H-isochromen-7-yl 3,4,6-trihydroxy-2-methylbenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878453 | Reaxys |
| Citations |
|---|