EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O11 |
| Net Charge | 0 |
| Average Mass | 434.353 |
| Monoisotopic Mass | 434.08491 |
| SMILES | O=c1c(O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C20H18O11/c21-8-4-11(24)14-13(5-8)30-18(7-1-2-9(22)10(23)3-7)19(16(14)27)31-20-17(28)15(26)12(25)6-29-20/h1-5,12,15,17,20-26,28H,6H2/t12-,15+,17-,20+/m1/s1 |
| InChIKey | PZZRDJXEMZMZFD-BWYUNELBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mimosa diplotricha (ncbitaxon:512270) | aerial part (BTO:0001658) | PubMed (21875046) | Ethanolic extract of aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin-3-O-β-D-xylopyranoside (CHEBI:69456) has role plant metabolite (CHEBI:76924) |
| quercetin-3-O-β-D-xylopyranoside (CHEBI:69456) is a monosaccharide derivative (CHEBI:63367) |
| quercetin-3-O-β-D-xylopyranoside (CHEBI:69456) is a quercetin O-glycoside (CHEBI:76424) |
| quercetin-3-O-β-D-xylopyranoside (CHEBI:69456) is a tetrahydroxyflavone (CHEBI:38684) |
| quercetin-3-O-β-D-xylopyranoside (CHEBI:69456) is a xylose derivative (CHEBI:74865) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl β-D-xylopyranoside |
| Synonym | Source |
|---|---|
| reynoutrin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1276426 | Reaxys |
| Citations |
|---|