EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(C)(C)[C@@H](O)CC[C@@]34C[C@@]14CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C30H50O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h9,21-25,31H,8,10-19H2,1-7H3/t21-,22-,23+,24+,25+,27-,28+,29-,30+/m1/s1 |
| InChIKey | ONQRKEUAIJMULO-YBXTVTTCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anodendron paniculatum (ncbitaxon:429536) | aerial part (BTO:0001658) | PubMed (28657349) | |
| Areca catechu (ncbitaxon:184783) | fruit (BTO:0000486) | PubMed (22876678) | |
| Garcinia subelliptica (ncbitaxon:212238) | leaf (BTO:0000713) | PubMed (23649198) | |
| Glycine max (ncbitaxon:3847) | seed (PO:0009010) | PubMed (11557074) | |
| Lycium ruthenicum (ncbitaxon:112879) | seed (BTO:0001226) | PubMed (30178878) | Isolated from seed oil. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cycloartenol (CHEBI:17030) has parent hydride lanostane (CHEBI:20265) |
| cycloartenol (CHEBI:17030) has role plant metabolite (CHEBI:76924) |
| cycloartenol (CHEBI:17030) is a 3β-sterol (CHEBI:35348) |
| cycloartenol (CHEBI:17030) is a pentacyclic triterpenoid (CHEBI:25872) |
| cycloartenol (CHEBI:17030) is a phytosterols (CHEBI:26125) |
| Incoming Relation(s) |
| 24-methylenecycloartenol (CHEBI:19813) has functional parent cycloartenol (CHEBI:17030) |
| 3-O-feruloylcycloartenol (CHEBI:69436) has functional parent cycloartenol (CHEBI:17030) |
| IUPAC Name |
|---|
| (3β,9β)-9,19-cyclolanost-24-en-3-ol |
| Synonyms | Source |
|---|---|
| 9β,19-cyclo-24-lanosten-3β-ol | KEGG COMPOUND |
| Cycloartenol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| cycloartenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003650 | KNApSAcK |
| C01902 | KEGG COMPOUND |
| C01902 | KEGG COMPOUND |
| Cycloartenol | Wikipedia |
| CYCLOARTENOL | MetaCyc |
| FDB015503 | FooDB |
| HMDB0036591 | HMDB |
| LMST01100008 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:469-38-5 | KEGG COMPOUND |
| CAS:469-38-5 | ChemIDplus |
| Citations |
|---|