EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N2O2 |
| Net Charge | 0 |
| Average Mass | 304.349 |
| Monoisotopic Mass | 304.12118 |
| SMILES | NC(=O)c1cn(-c2ccccc2)c(Cc2ccccc2)cc1=O |
| InChI | InChI=1S/C19H16N2O2/c20-19(23)17-13-21(15-9-5-2-6-10-15)16(12-18(17)22)11-14-7-3-1-4-8-14/h1-10,12-13H,11H2,(H2,20,23) |
| InChIKey | CIDPXFDZWQRYLZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (21854017) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nygerone B (CHEBI:69409) has role Aspergillus metabolite (CHEBI:76956) |
| nygerone B (CHEBI:69409) is a 4-pyridones (CHEBI:20485) |
| nygerone B (CHEBI:69409) is a biaryl (CHEBI:64459) |
| nygerone B (CHEBI:69409) is a monocarboxylic acid amide (CHEBI:29347) |
| Incoming Relation(s) |
| p-fluoro nygerone B (CHEBI:69410) has functional parent nygerone B (CHEBI:69409) |
| nygerone A (CHEBI:69408) has functional parent nygerone B (CHEBI:69409) |
| IUPAC Name |
|---|
| 6-benzyl-4-oxo-1-phenyl-1,4-dihydropyridine-3-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19781448 | Reaxys |
| Citations |
|---|