EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22N2O5 |
| Net Charge | 0 |
| Average Mass | 418.449 |
| Monoisotopic Mass | 418.15287 |
| SMILES | C[C@@H](CC(=O)NC(=O)c1cn(-c2ccccc2)c(Cc2ccccc2)cc1=O)C(=O)O |
| InChI | InChI=1S/C24H22N2O5/c1-16(24(30)31)12-22(28)25-23(29)20-15-26(18-10-6-3-7-11-18)19(14-21(20)27)13-17-8-4-2-5-9-17/h2-11,14-16H,12-13H2,1H3,(H,30,31)(H,25,28,29)/t16-/m0/s1 |
| InChIKey | NTTJVIQCCNYXRP-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (21854017) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nygerone A (CHEBI:69408) has functional parent nygerone B (CHEBI:69409) |
| nygerone A (CHEBI:69408) has role Aspergillus metabolite (CHEBI:76956) |
| nygerone A (CHEBI:69408) is a 4-pyridones (CHEBI:20485) |
| nygerone A (CHEBI:69408) is a biaryl (CHEBI:64459) |
| nygerone A (CHEBI:69408) is a dicarboximide (CHEBI:35356) |
| nygerone A (CHEBI:69408) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-4-{[(6-benzyl-4-oxo-1-phenyl-1,4-dihydropyridin-3-yl)carbonyl]amino}-2-methyl-4-oxobutanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19781449 | Reaxys |
| Citations |
|---|