EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38O19 |
| Net Charge | 0 |
| Average Mass | 726.637 |
| Monoisotopic Mass | 726.20073 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](Oc3c(-c4ccc(O)c(O)c4)oc4cc(O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)cc(O)c4c3=O)OC[C@H](O)[C@@H]2O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C32H38O19/c1-9-19(37)23(41)25(43)30(46-9)48-12-6-15(35)18-17(7-12)49-27(11-3-4-13(33)14(34)5-11)28(22(18)40)50-32-29(21(39)16(36)8-45-32)51-31-26(44)24(42)20(38)10(2)47-31/h3-7,9-10,16,19-21,23-26,29-39,41-44H,8H2,1-2H3/t9-,10-,16-,19-,20-,21-,23+,24+,25+,26+,29+,30-,31-,32-/m0/s1 |
| InChIKey | NVNDXAJMMOSZAJ-VJAYFQCDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anthyllis hermanniae (ncbitaxon:181246) | whole plant (BTO:0001461) | PubMed (21861458) | Methanolic extract of air dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hermannioside A (CHEBI:69377) has role plant metabolite (CHEBI:76924) |
| hermannioside A (CHEBI:69377) is a quercetin O-glycoside (CHEBI:76424) |
| hermannioside A (CHEBI:69377) is a trihydroxyflavone (CHEBI:27116) |
| hermannioside A (CHEBI:69377) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| 3-{[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy}-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl 6-deoxy-α-L-mannopyranoside |
| Synonym | Source |
|---|---|
| quercetin 3-O-[α-L-rhamnopyranosyl-(1→2)-α-L-arabinopyranoside]-7-O-α-L-rhamnopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21897855 | Reaxys |
| Citations |
|---|