EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2OC)cc1O |
| InChI | InChI=1S/C18H16O8/c1-23-11-5-4-8(6-9(11)19)16-18(25-3)15(22)13-12(26-16)7-10(20)17(24-2)14(13)21/h4-7,19-21H,1-3H3 |
| InChIKey | BZXULYMZYPRZOG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Athroisma proteiforme (IPNI:182889-1) | aerial part (BTO:0001658) | PubMed (21995542) | Ethyl alcohol extract of dried, ground aerial parts. |
| Eremophila mitchellii (IPNI:585196-1) | leaf (BTO:0000713) | PubMed (21877688) | n-Hexane,Methylene dichloride and methanolic extarct of airdried and ground leaves |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| centaureidin (CHEBI:69356) has role antineoplastic agent (CHEBI:35610) |
| centaureidin (CHEBI:69356) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| centaureidin (CHEBI:69356) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| centaureidin (CHEBI:69356) has role plant metabolite (CHEBI:76924) |
| centaureidin (CHEBI:69356) is a trihydroxyflavone (CHEBI:27116) |
| centaureidin (CHEBI:69356) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7,3'-trihydroxy-3,6,4'-trimethoxyflavone | LIPID MAPS |
| 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6-dimethoxy-4H-1-benzopyran-4-one | ChemIDplus |
| desmethoxycentaureidine | LIPID MAPS |
| quercetagetin 3,6,4'-trimethyl ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Centaureidin | Wikipedia |
| LMPK12113000 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:347389 | Reaxys |
| CAS:17313-52-9 | ChemIDplus |
| Citations |
|---|