EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H36O18 |
| Net Charge | 0 |
| Average Mass | 864.765 |
| Monoisotopic Mass | 864.19016 |
| SMILES | [H][C@@]12c3c(O)cc(O)cc3O[C@@](c3ccc(O)c(O)c3)(Oc3cc(O)c4c(c31)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]4c1c(O)cc(O)c3c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C3)[C@@H]2O |
| InChI | InChI=1S/C45H36O18/c46-18-10-27(54)33-31(11-18)62-45(17-3-6-22(49)26(53)9-17)44(59)38(33)36-32(63-45)14-29(56)35-37(39(58)41(61-43(35)36)16-2-5-21(48)25(52)8-16)34-28(55)13-23(50)19-12-30(57)40(60-42(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,30,37-41,44,46-59H,12H2/t30-,37+,38-,39-,40-,41-,44-,45+/m1/s1 |
| InChIKey | BYSRPHRKESMCPO-LQNPQWRQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cinnamomum aromaticum (ncbitaxon:119260) | bark (BTO:0001301) | PubMed (21875098) | 1.70% aqueous acetone extract of ground bark powder2.compound contains 1.4:1 coformational isomers |
| Cinnamomum zeylanicum (ncbitaxon:128608) | - | PubMed (21875098) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinnamtannin B-1 (CHEBI:69304) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| cinnamtannin B-1 (CHEBI:69304) has role plant metabolite (CHEBI:76924) |
| cinnamtannin B-1 (CHEBI:69304) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,3R,4S,8S,14R,15R)-2,8-bis(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-3,4-dihydro-2H,8H,14H-8,14-methano-1,7,9-trioxabenzo[6,7]cycloocta[1,2-a]naphthalene-3,5,11,13,15-pentol |
| Manual Xrefs | Databases |
|---|---|
| C17631 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4227704 | Reaxys |
| Citations |
|---|