EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O3 |
| Net Charge | 0 |
| Average Mass | 284.355 |
| Monoisotopic Mass | 284.14124 |
| SMILES | C[C@@H]1[C@H](C)[C@@H](c2ccc(O)cc2)O[C@@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O3/c1-11-12(2)18(14-5-9-16(20)10-6-14)21-17(11)13-3-7-15(19)8-4-13/h3-12,17-20H,1-2H3/t11-,12+,17-,18-/m0/s1 |
| InChIKey | PIBJADPEZQHMQS-CMKMFDCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Krameria lappacea (ncbitaxon:228636) | root (BTO:0001188) | PubMed (21800856) | Methylene dichloride extract of dried and ground roots |
| Roles Classification |
|---|
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-larreatricin (CHEBI:69246) has role anti-inflammatory agent (CHEBI:67079) |
| (−)-larreatricin (CHEBI:69246) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| (−)-larreatricin (CHEBI:69246) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| (−)-larreatricin (CHEBI:69246) has role NF-κB inhibitor (CHEBI:73240) |
| (−)-larreatricin (CHEBI:69246) has role plant metabolite (CHEBI:76924) |
| (−)-larreatricin (CHEBI:69246) is a lignan (CHEBI:25036) |
| (−)-larreatricin (CHEBI:69246) is a oxolanes (CHEBI:26912) |
| (−)-larreatricin (CHEBI:69246) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4,4'-[(2S,3R,4S,5S)-3,4-dimethyloxolane-2,5-diyl]diphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4236154 | Reaxys |
| Citations |
|---|