EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18NO.Cl |
| Net Charge | 0 |
| Average Mass | 215.724 |
| Monoisotopic Mass | 215.10769 |
| SMILES | Cc1cccc(C)c1OCC(C)[NH3+].[Cl-] |
| InChI | InChI=1S/C11H17NO.ClH/c1-8-5-4-6-9(2)11(8)13-7-10(3)12;/h4-6,10H,7,12H2,1-3H3;1H |
| InChIKey | NFEIBWMZVIVJLQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mexiletine hydrochloride (CHEBI:6917) has part mexiletine (CHEBI:6916) |
| mexiletine hydrochloride (CHEBI:6917) has role anti-arrhythmia drug (CHEBI:38070) |
| mexiletine hydrochloride (CHEBI:6917) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 1-(2,6-dimethylphenoxy)propan-2-aminium chloride |
| 1-(2,6-dimethylphenoxy)propan-2-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 1-(2,6-dimethylphenoxy)-2-propanamine hydrochloride | ChemIDplus |
| 1-methyl-2-(2,6-xylyloxy)ethylamine hydrochloride | ChemIDplus |
| mexiletine HCl | ChemIDplus |
| 1-(2,6-dimethylphenoxy)-2-aminopropane hydrochloride | ChemIDplus |
| (±)-1-methyl-2-(2,6-xylyloxy)ethylamine hydrochloride | ChemIDplus |
| 1-methyl-2-(2,6-xylyloxy)ethylammonium chloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Mexitil | KEGG DRUG |