EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO |
| Net Charge | 0 |
| Average Mass | 179.263 |
| Monoisotopic Mass | 179.13101 |
| SMILES | Cc1cccc(C)c1OCC(C)N |
| InChI | InChI=1S/C11H17NO/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6,10H,7,12H2,1-3H3 |
| InChIKey | VLPIATFUUWWMKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mexiletine (CHEBI:6916) has role anti-arrhythmia drug (CHEBI:38070) |
| mexiletine (CHEBI:6916) is a aromatic ether (CHEBI:35618) |
| mexiletine (CHEBI:6916) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| mexiletine hydrochloride (CHEBI:6917) has part mexiletine (CHEBI:6916) |
| IUPAC Name |
|---|
| 1-(2,6-dimethylphenoxy)propan-2-amine |
| INNs | Source |
|---|---|
| mexiletina | ChemIDplus |
| mexiletine | ChemIDplus |
| mexiletinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2',6'-dimethylphenoxy)-2-aminopropane | NIST Chemistry WebBook |
| 1-(2,6-dimethylphenoxy)-2-propanamine | NIST Chemistry WebBook |
| (±)-1-(2,6-dimethylphenoxy)propan-2-amine | ChEBI |
| 1-methyl-2-(2,6-xylyloxy)ethanamine | NIST Chemistry WebBook |
| (2RS)-1-(2,6-dimethylphenoxy)-2-aminopropane | ChEBI |
| Mexiletine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1794 | DrugCentral |
| C07220 | KEGG COMPOUND |
| D08215 | KEGG DRUG |
| DB00379 | DrugBank |
| FR1551055 | Patent |
| HMDB0014523 | HMDB |
| LSM-1700 | LINCS |
| Mexiletine | Wikipedia |
| US3954872 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2092205 | Reaxys |
| CAS:31828-71-4 | NIST Chemistry WebBook |
| CAS:31828-71-4 | KEGG COMPOUND |
| CAS:31828-71-4 | ChemIDplus |
| Citations |
|---|