EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO |
| Net Charge | 0 |
| Average Mass | 179.263 |
| Monoisotopic Mass | 179.13101 |
| SMILES | Cc1cccc(C)c1OCC(C)N |
| InChI | InChI=1S/C11H17NO/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6,10H,7,12H2,1-3H3 |
| InChIKey | VLPIATFUUWWMKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mexiletine (CHEBI:6916) has role analgesic (CHEBI:35480) |
| mexiletine (CHEBI:6916) has role anti-arrhythmia drug (CHEBI:38070) |
| mexiletine (CHEBI:6916) has role antispasmodic drug (CHEBI:53784) |
| mexiletine (CHEBI:6916) has role cardiovascular drug (CHEBI:35554) |
| mexiletine (CHEBI:6916) is a aromatic ether (CHEBI:35618) |
| mexiletine (CHEBI:6916) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| mexiletine hydrochloride (CHEBI:6917) has part mexiletine (CHEBI:6916) |
| IUPAC Name |
|---|
| 1-(2,6-dimethylphenoxy)propan-2-amine |
| INNs | Source |
|---|---|
| mexiletina | ChemIDplus |
| mexiletine | ChemIDplus |
| mexiletinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2',6'-dimethylphenoxy)-2-aminopropane | NIST Chemistry WebBook |
| 1-(2,6-dimethylphenoxy)-2-propanamine | NIST Chemistry WebBook |
| (±)-1-(2,6-dimethylphenoxy)propan-2-amine | ChEBI |
| 1-methyl-2-(2,6-xylyloxy)ethanamine | NIST Chemistry WebBook |
| (2RS)-1-(2,6-dimethylphenoxy)-2-aminopropane | ChEBI |
| Mexiletine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1794 | DrugCentral |
| C07220 | KEGG COMPOUND |
| D08215 | KEGG DRUG |
| DB00379 | DrugBank |
| FR1551055 | Patent |
| HMDB0014523 | HMDB |
| LSM-1700 | LINCS |
| Mexiletine | Wikipedia |
| US3954872 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2092205 | Reaxys |
| CAS:31828-71-4 | ChemIDplus |
| CAS:31828-71-4 | NIST Chemistry WebBook |
| CAS:31828-71-4 | KEGG COMPOUND |
| Citations |
|---|