EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@]12CCc3cocc3[C@]1(C)CC[C@]1([H])[C@]2(C)CCC[C@]1(C)C(=O)O |
| InChI | InChI=1S/C20H28O3/c1-18-10-7-16-19(2,8-4-9-20(16,3)17(21)22)15(18)6-5-13-11-23-12-14(13)18/h11-12,15-16H,4-10H2,1-3H3,(H,21,22)/t15-,16+,18-,19+,20-/m0/s1 |
| InChIKey | KJCLDWYEUKTPNA-ZRSLWSEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia (ncbitaxon:121489) | - | PubMed (22129061) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) has role androgen antagonist (CHEBI:35497) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) has role metabolite (CHEBI:25212) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) is a cyclic ether (CHEBI:37407) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) is a monocarboxylic acid (CHEBI:25384) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (3bR,5aR,6S,9aR,9bR)-3b,6,9a-trimethyl-3b,4,5,5a,6,7,8,9,9a,9b,10,11-dodecahydrophenanthro[1,2-c]furan-6-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5592475 | Reaxys |
| Citations |
|---|