EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@]12CCc3cocc3[C@]1(C)CC[C@]1([H])[C@]2(C)CCC[C@]1(C)C(=O)O |
| InChI | InChI=1S/C20H28O3/c1-18-10-7-16-19(2,8-4-9-20(16,3)17(21)22)15(18)6-5-13-11-23-12-14(13)18/h11-12,15-16H,4-10H2,1-3H3,(H,21,22)/t15-,16+,18-,19+,20-/m0/s1 |
| InChIKey | KJCLDWYEUKTPNA-ZRSLWSEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia (ncbitaxon:121489) | - | PubMed (22129061) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Application: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) has role androgen antagonist (CHEBI:35497) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) has role metabolite (CHEBI:25212) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) is a cyclic ether (CHEBI:37407) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) is a monocarboxylic acid (CHEBI:25384) |
| spongia-13(16),14-dien-19-oic acid (CHEBI:69143) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (3bR,5aR,6S,9aR,9bR)-3b,6,9a-trimethyl-3b,4,5,5a,6,7,8,9,9a,9b,10,11-dodecahydrophenanthro[1,2-c]furan-6-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5592475 | Reaxys |
| Citations |
|---|