EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H50O7 |
| Net Charge | 0 |
| Average Mass | 462.668 |
| Monoisotopic Mass | 462.35565 |
| SMILES | CCCCCCC(C)CCCCCCCCCOC[C@H](O)COC1[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H50O7/c1-3-4-5-11-14-19(2)15-12-9-7-6-8-10-13-16-31-17-20(26)18-32-25-23(29)21(27)22(28)24(25)30/h19-30H,3-18H2,1-2H3/t19?,20-,21+,22+,23-,24-/m0/s1 |
| InChIKey | PBKNPWUTVIEHAJ-PUZAKDQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cacospongia mycofijiensis (ncbitaxon:1162744) | - | PubMed (22129061) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sacrotride A (CHEBI:69138) has role metabolite (CHEBI:25212) |
| sacrotride A (CHEBI:69138) is a pentose (CHEBI:25901) |
| Synonym | Source |
|---|---|
| (1S,2R,3R,4S)-5-{(2S)-2-Hydroxy-3-[(10-methylhexadecyl)oxy]propoxy}-1,2,3,4-cyclopentanetetrol | ChEBI |
| Citations |
|---|