EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34O5 |
| Net Charge | 0 |
| Average Mass | 438.564 |
| Monoisotopic Mass | 438.24062 |
| SMILES | [H][C@@]1(c2ccc(O)c(CC=C(C)C)c2O)COc2cc(OC)c(CC=C(C)C)c(OC)c2C1 |
| InChI | InChI=1S/C27H34O5/c1-16(2)7-9-20-23(28)12-11-19(26(20)29)18-13-22-25(32-15-18)14-24(30-5)21(27(22)31-6)10-8-17(3)4/h7-8,11-12,14,18,28-29H,9-10,13,15H2,1-6H3/t18-/m0/s1 |
| InChIKey | GDAAEAXMNLVRCZ-SFHVURJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| licorisoflavan A (CHEBI:69083) has functional parent licoricidin (CHEBI:69082) |
| licorisoflavan A (CHEBI:69083) has role antibacterial agent (CHEBI:33282) |
| licorisoflavan A (CHEBI:69083) has role plant metabolite (CHEBI:76924) |
| licorisoflavan A (CHEBI:69083) is a aromatic ether (CHEBI:35618) |
| licorisoflavan A (CHEBI:69083) is a hydroxyisoflavans (CHEBI:76250) |
| licorisoflavan A (CHEBI:69083) is a methoxyisoflavan (CHEBI:77002) |
| IUPAC Name |
|---|
| 4-[(3R)-5,7-dimethoxy-6-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H-chromen-3-yl]-2-(3-methylbut-2-en-1-yl)benzene-1,3-diol |
| Synonyms | Source |
|---|---|
| (+)-2',4'-dihydroxy-5,7-dimethoxy-6,3'-diprenylisoflavan | LIPID MAPS |
| 5-O-methyllicoricidin | ChemIDplus |
| 7-O-methyllicoricidin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034184 | HMDB |
| LMPK12080046 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5461708 | Reaxys |
| CAS:129314-37-0 | ChemIDplus |
| Citations |
|---|