EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O5 |
| Net Charge | 0 |
| Average Mass | 424.537 |
| Monoisotopic Mass | 424.22497 |
| SMILES | [H][C@@]1(c2ccc(O)c(CC=C(C)C)c2O)COc2cc(O)c(CC=C(C)C)c(OC)c2C1 |
| InChI | InChI=1S/C26H32O5/c1-15(2)6-8-19-22(27)11-10-18(25(19)29)17-12-21-24(31-14-17)13-23(28)20(26(21)30-5)9-7-16(3)4/h6-7,10-11,13,17,27-29H,8-9,12,14H2,1-5H3/t17-/m0/s1 |
| InChIKey | GBRZTUJCDFSIHM-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| licoricidin (CHEBI:69082) has role antibacterial agent (CHEBI:33282) |
| licoricidin (CHEBI:69082) has role plant metabolite (CHEBI:76924) |
| licoricidin (CHEBI:69082) is a aromatic ether (CHEBI:35618) |
| licoricidin (CHEBI:69082) is a hydroxyisoflavans (CHEBI:76250) |
| licoricidin (CHEBI:69082) is a methoxyisoflavan (CHEBI:77002) |
| Incoming Relation(s) |
| licorisoflavan A (CHEBI:69083) has functional parent licoricidin (CHEBI:69082) |
| IUPAC Name |
|---|
| 4-[(3R)-7-hydroxy-5-methoxy-6-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H-chromen-3-yl]-2-(3-methylbut-2-en-1-yl)benzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 4-((R)-7-hydroxy-5-methoxy-6-(3-methyl-but-2-enyl)-1-benzopyran-3-yl)-2-((E)-3-methyl-but-2-enyl)-benzene-1,3-diol | ChemIDplus |
| 2',4',7'-trihydroxy-5-methoxy-3',6-diisopentenyl-isoflavan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12080045 | LIPID MAPS |
| C16986 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5362788 | Reaxys |
| CAS:30508-27-1 | ChemIDplus |
| CAS:30508-27-1 | KEGG COMPOUND |
| Citations |
|---|