EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | CC(C)=CCc1cc2ccc(=O)oc2cc1O |
| InChI | InChI=1S/C14H14O3/c1-9(2)3-4-10-7-11-5-6-14(16)17-13(11)8-12(10)15/h3,5-8,15H,4H2,1-2H3 |
| InChIKey | FIDUIAPDSKSUGO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica dahurica var. formosana (ncbitaxon:714446) | root (BTO:0001188) | PubMed (26552172) | |
| Angelica gigas (ncbitaxon:85712) | root (BTO:0001188) | PubMed (17997069) | |
| Citropsis articulata (IPNI:771824-1) | root (BTO:0001188) | PubMed (21985060) | Previous component: root bark; Ethyl acetate extract of dried, powdered root bark. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-demethylsuberosin (CHEBI:69042) has role plant metabolite (CHEBI:76924) |
| 7-demethylsuberosin (CHEBI:69042) is a hydroxycoumarin (CHEBI:37912) |
| Incoming Relation(s) |
| suberosin (CHEBI:69041) has functional parent 7-demethylsuberosin (CHEBI:69042) |
| IUPAC Name |
|---|
| 7-hydroxy-6-(3-methylbut-2-en-1-yl)-2H-chromen-2-one |
| Synonym | Source |
|---|---|
| 7-hydroxy-6-prenylcoumarin | ChEBI |
| UniProt Name | Source |
|---|---|
| demethylsuberosin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:188724 | Reaxys |
| CAS:21422-04-8 | ChemIDplus |
| CAS:21422-04-8 | KEGG COMPOUND |
| Citations |
|---|