EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O3 |
| Net Charge | 0 |
| Average Mass | 244.290 |
| Monoisotopic Mass | 244.10994 |
| SMILES | COc1cc2oc(=O)ccc2cc1CC=C(C)C |
| InChI | InChI=1S/C15H16O3/c1-10(2)4-5-11-8-12-6-7-15(16)18-14(12)9-13(11)17-3/h4,6-9H,5H2,1-3H3 |
| InChIKey | RSZDAYHEZSRVHS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citropsis articulata (IPNI:771824-1) | root (BTO:0001188) | PubMed (21985060) | Previous component: root bark; Cyclohexane and ethyl acetate extract of dried, powdered root bark. |
| Cachrys cristata (ncbitaxon:1079708) | fruit body (BTO:0000487) | PubMed (22474967) | Found in the fruit oil |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suberosin (CHEBI:69041) has functional parent 7-demethylsuberosin (CHEBI:69042) |
| suberosin (CHEBI:69041) has role anticoagulant (CHEBI:50249) |
| suberosin (CHEBI:69041) has role plant metabolite (CHEBI:76924) |
| suberosin (CHEBI:69041) is a aromatic ether (CHEBI:35618) |
| suberosin (CHEBI:69041) is a coumarins (CHEBI:23403) |
| IUPAC Name |
|---|
| 7-methoxy-6-(3-methylbut-2-en-1-yl)-2H-chromen-2-one |
| Synonyms | Source |
|---|---|
| 7-Methoxy-6-(3-methyl-2-buten-1-yl)-2H-chromen-2-one | ChEBI |
| 7-methoxy-6-prenylcoumarin | ChEBI |
| Citations |
|---|