EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42O6 |
| Net Charge | 0 |
| Average Mass | 510.671 |
| Monoisotopic Mass | 510.29814 |
| SMILES | CCC(C)CC(C)/C=C(C)/C=C/C(=O)C[C@H]1C2=COC([C@H]3C(=O)C[C@H](O)C[C@@H]3C)=CC2=CC(=O)[C@]1(C)O |
| InChI | InChI=1S/C31H42O6/c1-7-18(2)10-20(4)11-19(3)8-9-23(32)15-26-25-17-37-28(13-22(25)14-29(35)31(26,6)36)30-21(5)12-24(33)16-27(30)34/h8-9,11,13-14,17-18,20-21,24,26,30,33,36H,7,10,12,15-16H2,1-6H3/b9-8+,19-11+/t18?,20?,21-,24+,26-,30+,31+/m0/s1 |
| InChIKey | PZWVXQVKPAZYRZ-GIIUFEGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium longirostre (ncbitaxon:669026) | |||
| - | PubMed (22004007) | ||
| - | PubMed (22004007) | Ethyl acetate extract of dried fungal biomass |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| longirostrerone B (CHEBI:68981) has role Chaetomium metabolite (CHEBI:76960) |
| longirostrerone B (CHEBI:68981) has role antimalarial (CHEBI:38068) |
| longirostrerone B (CHEBI:68981) has role antineoplastic agent (CHEBI:35610) |
| longirostrerone B (CHEBI:68981) is a azaphilone (CHEBI:50941) |
| longirostrerone B (CHEBI:68981) is a enone (CHEBI:51689) |
| longirostrerone B (CHEBI:68981) is a organic heterobicyclic compound (CHEBI:27171) |
| longirostrerone B (CHEBI:68981) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (7R,8S)-7-hydroxy-3-[(1S,2S,4R)-4-hydroxy-2-methyl-6-oxocyclohexyl]-7-methyl-8-[(3E,5E)-5,7,9-trimethyl-2-oxoundeca-3,5-dien-1-yl]-7,8-dihydro-6H-isochromen-6-one |
| Synonym | Source |
|---|---|
| 7-hydroxy-3-(4-hydroxy-6-methyl-2-oxocyclohexyl)-8-(5,7,9-trimethylundeca-3,5-dienoyl)-(7R)-7-methyl-8-hydro-7H-furo-[2,3-h]isochromene-6,18-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123574 | Reaxys |
| Citations |
|---|