EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H20N4O5 |
| Net Charge | 0 |
| Average Mass | 456.458 |
| Monoisotopic Mass | 456.14337 |
| SMILES | CCOc1nc2cccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2-c2noc(=O)n2)cc1 |
| InChI | InChI=1S/C25H20N4O5/c1-2-33-24-26-20-9-5-8-19(23(30)31)21(20)29(24)14-15-10-12-16(13-11-15)17-6-3-4-7-18(17)22-27-25(32)34-28-22/h3-13H,2,14H2,1H3,(H,30,31)(H,27,28,32) |
| InChIKey | KGSXMPPBFPAXLY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azilsartan (CHEBI:68850) has role angiotensin receptor antagonist (CHEBI:61016) |
| azilsartan (CHEBI:68850) has role antihypertensive agent (CHEBI:35674) |
| azilsartan (CHEBI:68850) is a 1,2,4-oxadiazole (CHEBI:46809) |
| azilsartan (CHEBI:68850) is a aromatic ether (CHEBI:35618) |
| azilsartan (CHEBI:68850) is a benzimidazolecarboxylic acid (CHEBI:35688) |
| Incoming Relation(s) |
| azilsartan medoxomil (CHEBI:68845) has functional parent azilsartan (CHEBI:68850) |
| IUPAC Name |
|---|
| 2-ethoxy-1-{[2'-(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylic acid |
| INN | Source |
|---|---|
| azilsartan | KEGG DRUG |
| Synonyms | Source |
|---|---|
| TAK-536 | ChemIDplus |
| TAK 536 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08864 | KEGG DRUG |
| WO2012107814 | Patent |
| US2005187269 | Patent |
| EP1787647 | Patent |
| Azilsartan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7673311 | Reaxys |
| CAS:147403-03-0 | KEGG DRUG |
| CAS:147403-03-0 | ChemIDplus |
| Citations |
|---|