EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O5 |
| Net Charge | 0 |
| Average Mass | 246.263 |
| Monoisotopic Mass | 246.12157 |
| SMILES | CC(C)[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N2O5/c1-5(2)8(10(16)17)12-7(13)4-3-6(11)9(14)15/h5-6,8H,3-4,11H2,1-2H3,(H,12,13)(H,14,15)(H,16,17)/t6-,8-/m0/s1 |
| InChIKey | AQAKHZVPOOGUCK-XPUUQOCRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (3782411) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Val (CHEBI:68848) has role human metabolite (CHEBI:77746) |
| γ-Glu-Val (CHEBI:68848) is a glutamyl-L-amino acid (CHEBI:24323) |
| γ-Glu-Val (CHEBI:68848) is conjugate acid of γ-Glu-Val(1−) (CHEBI:133642) |
| Incoming Relation(s) |
| γ-Glu-Val(1−) (CHEBI:133642) is conjugate base of γ-Glu-Val (CHEBI:68848) |
| IUPAC Names |
|---|
| (2S)-2-amino-5-{[(1S)-1-carboxy-2-methylpropyl]amino}-5-oxopentanoic acid |
| L-γ-glutamyl-L-valine |
| Synonyms | Source |
|---|---|
| gamma-Glutamylvaline | HMDB |
| L-γ-Glu-L-Val | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011172 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1714841 | Reaxys |
| Citations |
|---|