EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N2O5 |
| Net Charge | -1 |
| Average Mass | 245.255 |
| Monoisotopic Mass | 245.11430 |
| SMILES | CC(C)[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H18N2O5/c1-5(2)8(10(16)17)12-7(13)4-3-6(11)9(14)15/h5-6,8H,3-4,11H2,1-2H3,(H,12,13)(H,14,15)(H,16,17)/p-1/t6-,8-/m0/s1 |
| InChIKey | AQAKHZVPOOGUCK-XPUUQOCRSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Val(1−) (CHEBI:133642) has role human metabolite (CHEBI:77746) |
| γ-Glu-Val(1−) (CHEBI:133642) is a peptide anion (CHEBI:60334) |
| γ-Glu-Val(1−) (CHEBI:133642) is conjugate base of γ-Glu-Val (CHEBI:68848) |
| Incoming Relation(s) |
| γ-Glu-Val (CHEBI:68848) is conjugate acid of γ-Glu-Val(1−) (CHEBI:133642) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S)-1-carboxylato-2-methylpropyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| γ-glutamylvalinate | ChEBI |
| γ-L-Glu-L-Val(1−) | ChEBI |
| γ-L-glutamyl-L-valinate | ChEBI |