EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31GdN4O9 |
| Net Charge | 0 |
| Average Mass | 604.715 |
| Monoisotopic Mass | 605.13321 |
| SMILES | O=C([O-])C[N+]12CC[N+]3(CC(=O)[O-])CC[N+]4([C@@H](CO)[C@@H](O)CO)CC[N+](CC(=O)[O-])(CC1)[Gd-]234 |
| InChI | InChI=1S/C18H34N4O9.Gd/c23-12-14(15(25)13-24)22-7-5-20(10-17(28)29)3-1-19(9-16(26)27)2-4-21(6-8-22)11-18(30)31;/h14-15,23-25H,1-13H2,(H,26,27)(H,28,29)(H,30,31);/q;+3/p-3/t14-,15-;/m0./s1 |
| InChIKey | ZPDFIIGFYAHNSK-YYLIZZNMSA-K |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gadobutrol (CHEBI:68841) has role antineoplastic agent (CHEBI:35610) |
| gadobutrol (CHEBI:68841) has role antirheumatic drug (CHEBI:35842) |
| gadobutrol (CHEBI:68841) has role cardiovascular drug (CHEBI:35554) |
| gadobutrol (CHEBI:68841) has role MRI contrast agent (CHEBI:37335) |
| gadobutrol (CHEBI:68841) is a gadolinium coordination entity (CHEBI:35730) |
| IUPAC Name |
|---|
| rac-[2,2',2''-{10-[(2S,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetraazacyclododecane-1,4,7-triyl-κ4N1,N4,N7,N10}triacetato(3−)]gadolinium |
| INNs | Source |
|---|---|
| gadobutrol | KEGG DRUG |
| gadobutrol | WHO MedNet |
| gadobutrol | WHO MedNet |
| gadobutrolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY86-4875 | ChEMBL |
| Gadograf | ChEMBL |
| Gadolinium-DO3A-butriol | ChemIDplus |
| Gadovist | ChEMBL |
| Gd-DO3A-butriol | ChemIDplus |
| Protovist | ChEMBL |
| Brand Name | Source |
|---|---|
| Gadavist | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D07420 | KEGG DRUG |
| DB06703 | DrugBank |
| Gadobutrol | Wikipedia |
| HMDB0015649 | HMDB |
| US2007202047 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15557943 | Reaxys |
| CAS:770691-21-9 | ChemIDplus |
| Citations |
|---|