EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@]13CC(C)(C)C[C@@]3([H])C=C2C(=O)O |
| InChI | InChI=1S/C15H22O2/c1-9-4-5-12-11(13(16)17)6-10-7-14(2,3)8-15(9,10)12/h6,9-10,12H,4-5,7-8H2,1-3H3,(H,16,17)/t9-,10-,12+,15-/m1/s1 |
| InChIKey | DCFDRCCHOOORSB-DSKWVYQCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-deoxypentalenic acid (CHEBI:68832) has functional parent pentalenene (CHEBI:17251) |
| 1-deoxypentalenic acid (CHEBI:68832) has role metabolite (CHEBI:25212) |
| 1-deoxypentalenic acid (CHEBI:68832) is a carbotricyclic compound (CHEBI:38032) |
| 1-deoxypentalenic acid (CHEBI:68832) is a sesquiterpenoid (CHEBI:26658) |
| 1-deoxypentalenic acid (CHEBI:68832) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 1-deoxypentalenic acid (CHEBI:68832) is conjugate acid of 1-deoxypentalenate (CHEBI:68650) |
| Incoming Relation(s) |
| 1-deoxypentalenate (CHEBI:68650) is conjugate base of 1-deoxypentalenic acid (CHEBI:68832) |
| IUPAC Name |
|---|
| (1R,3aR,5aS,8aS)-1,7,7-trimethyl-1,2,3,3a,5a,6,7,8-octahydrocyclopenta[c]pentalene-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-13618 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22129929 | Reaxys |
| Citations |
|---|