EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O4 |
| Net Charge | 0 |
| Average Mass | 118.088 |
| Monoisotopic Mass | 118.02661 |
| SMILES | CC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C4H6O4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)(H,7,8) |
| InChIKey | ZIYVHBGGAOATLY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylmalonic acid (CHEBI:30860) has functional parent malonic acid (CHEBI:30794) |
| methylmalonic acid (CHEBI:30860) has role human metabolite (CHEBI:77746) |
| methylmalonic acid (CHEBI:30860) is a C4-dicarboxylic acid (CHEBI:66873) |
| methylmalonic acid (CHEBI:30860) is conjugate acid of methylmalonate(1−) (CHEBI:30861) |
| Incoming Relation(s) |
| O-methylmalonyl-L-carnitine (CHEBI:85473) has functional parent methylmalonic acid (CHEBI:30860) |
| aryl(methyl)malonic acid (CHEBI:15849) has functional parent methylmalonic acid (CHEBI:30860) |
| methylmalonyl-CoA (CHEBI:16625) has functional parent methylmalonic acid (CHEBI:30860) |
| methylmalonate(1−) (CHEBI:30861) is conjugate base of methylmalonic acid (CHEBI:30860) |
| IUPAC Name |
|---|
| methylpropanedioic acid |
| Synonyms | Source |
|---|---|
| Methylmalonic acid | KEGG COMPOUND |
| METHYLMALONIC ACID | PDBeChem |
| 2-methylmalonic acid | NIST Chemistry WebBook |
| 1,1-Ethanedicarboxylic acid | HMDB |
| α-methylmalonic acid | ChEBI |
| Isosuccinic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C02170 | KEGG COMPOUND |
| DXX | PDBeChem |
| CPD-546 | MetaCyc |
| HMDB0000202 | HMDB |
| Methylmalonic_acid | Wikipedia |
| DB04183 | DrugBank |
| LMFA01170118 | LIPID MAPS |
| Citations |
|---|