EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O4 |
| Net Charge | -1 |
| Average Mass | 117.080 |
| Monoisotopic Mass | 117.01933 |
| SMILES | CC(C(=O)[O-])C(=O)O |
| InChI | InChI=1S/C4H6O4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)(H,7,8)/p-1 |
| InChIKey | ZIYVHBGGAOATLY-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylmalonate(1−) (CHEBI:30861) has role human metabolite (CHEBI:77746) |
| methylmalonate(1−) (CHEBI:30861) is a dicarboxylic acid monoanion (CHEBI:35695) |
| methylmalonate(1−) (CHEBI:30861) is conjugate acid of methylmalonate(2−) (CHEBI:17453) |
| methylmalonate(1−) (CHEBI:30861) is conjugate base of methylmalonic acid (CHEBI:30860) |
| Incoming Relation(s) |
| methylmalonic acid (CHEBI:30860) is conjugate acid of methylmalonate(1−) (CHEBI:30861) |
| methylmalonate(2−) (CHEBI:17453) is conjugate base of methylmalonate(1−) (CHEBI:30861) |
| IUPAC Name |
|---|
| 2-carboxypropanoate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:142213 | Gmelin |
| Reaxys:5499681 | Reaxys |