EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N7O19P3S |
| Net Charge | 0 |
| Average Mass | 867.614 |
| Monoisotopic Mass | 867.13125 |
| SMILES | CC(C(=O)O)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C25H40N7O19P3S/c1-12(23(37)38)24(39)55-7-6-27-14(33)4-5-28-21(36)18(35)25(2,3)9-48-54(45,46)51-53(43,44)47-8-13-17(50-52(40,41)42)16(34)22(49-13)32-11-31-15-19(26)29-10-30-20(15)32/h10-13,16-18,22,34-35H,4-9H2,1-3H3,(H,27,33)(H,28,36)(H,37,38)(H,43,44)(H,45,46)(H2,26,29,30)(H2,40,41,42)/t12?,13-,16-,17-,18+,22-/m1/s1 |
| InChIKey | MZFOKIKEPGUZEN-FBMOWMAESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (17966092) |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylmalonyl-CoA (CHEBI:16625) has functional parent methylmalonic acid (CHEBI:30860) |
| methylmalonyl-CoA (CHEBI:16625) has role human metabolite (CHEBI:77746) |
| methylmalonyl-CoA (CHEBI:16625) is a malonyl-CoAs (CHEBI:25136) |
| methylmalonyl-CoA (CHEBI:16625) is conjugate acid of methylmalonyl-CoA(5−) (CHEBI:59916) |
| Incoming Relation(s) |
| (R)-methylmalonyl-CoA (CHEBI:15465) is a methylmalonyl-CoA (CHEBI:16625) |
| (S)-methylmalonyl-CoA (CHEBI:15466) is a methylmalonyl-CoA (CHEBI:16625) |
| methylmalonyl-CoA(5−) (CHEBI:59916) is conjugate base of methylmalonyl-CoA (CHEBI:16625) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-[3-(3-hydroxy-2,2-dimethyl-4-{[3-({2-[(2-methyl-3-oxopropanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| Methylmalonyl-CoA | KEGG COMPOUND |
| Methylmalonyl coemzyme A | KEGG COMPOUND |
| 2-Methylmalonyl-CoA | KEGG COMPOUND |
| 2-methyl-3-oxopropanoyl-CoAs | ChEBI |
| 2-methylmalonyl-CoA | ChEBI |
| methylmalonyl coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02557 | KEGG COMPOUND |
| MCA | PDBeChem |
| Methylmalonyl-CoA | MetaCyc |
| HMDB0001269 | HMDB |
| Methylmalonyl-CoA | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78364 | Reaxys |
| CAS:1264-45-5 | KEGG COMPOUND |
| CAS:1264-45-5 | ChemIDplus |
| Citations |
|---|