EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23ClO5 |
| Net Charge | 0 |
| Average Mass | 414.885 |
| Monoisotopic Mass | 414.12340 |
| SMILES | CC[C@H](C)/C=C(C)/C=C/C1=CC2=C(Cl)C(=O)[C@@]3(C)OC(=O)C(C(C)=O)=C3C2=CO1 |
| InChI | InChI=1S/C23H23ClO5/c1-6-12(2)9-13(3)7-8-15-10-16-17(11-28-15)19-18(14(4)25)22(27)29-23(19,5)21(26)20(16)24/h7-12H,6H2,1-5H3/b8-7+,13-9+/t12-,23-/m0/s1 |
| InChIKey | QJSWSNAZIVGTFZ-NPQXMUAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium cupreum (ncbitaxon:155874) | - | PubMed (16792406) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubrorotiorin (CHEBI:68787) has role Chaetomium metabolite (CHEBI:76960) |
| rubrorotiorin (CHEBI:68787) has role antifungal agent (CHEBI:35718) |
| rubrorotiorin (CHEBI:68787) is a azaphilone (CHEBI:50941) |
| rubrorotiorin (CHEBI:68787) is a enone (CHEBI:51689) |
| rubrorotiorin (CHEBI:68787) is a methyl ketone (CHEBI:51867) |
| rubrorotiorin (CHEBI:68787) is a organic heterotricyclic compound (CHEBI:26979) |
| rubrorotiorin (CHEBI:68787) is a organochlorine compound (CHEBI:36683) |
| rubrorotiorin (CHEBI:68787) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (6aS)-9-acetyl-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dien-1-yl]-6a-methyl-6H-furo[2,3-h]isochromene-6,8(6aH)-dione |
| Manual Xrefs | Databases |
|---|---|
| 10176672 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15840539 | Reaxys |
| CAS:28763-04-4 | ChemIDplus |
| Citations |
|---|