EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O6 |
| Net Charge | 0 |
| Average Mass | 398.455 |
| Monoisotopic Mass | 398.17294 |
| SMILES | CC(=O)C1=C2C=C3C=C(/C=C/C(C)=C/[C@@H](C)CCO)OC=C3[C@@H](O)[C@]2(C)OC1=O |
| InChI | InChI=1S/C23H26O6/c1-13(9-14(2)7-8-24)5-6-17-10-16-11-19-20(15(3)25)22(27)29-23(19,4)21(26)18(16)12-28-17/h5-6,9-12,14,21,24,26H,7-8H2,1-4H3/b6-5+,13-9+/t14-,21+,23+/m0/s1 |
| InChIKey | KRCVYHUEUHHWKT-XOEIKTSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium cupreum (ncbitaxon:155874) | - | PubMed (16792406) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rotiorinol C (CHEBI:68786) has role Chaetomium metabolite (CHEBI:76960) |
| rotiorinol C (CHEBI:68786) has role antifungal agent (CHEBI:35718) |
| rotiorinol C (CHEBI:68786) is a azaphilone (CHEBI:50941) |
| rotiorinol C (CHEBI:68786) is a methyl ketone (CHEBI:51867) |
| rotiorinol C (CHEBI:68786) is a organic heterotricyclic compound (CHEBI:26979) |
| rotiorinol C (CHEBI:68786) is a primary alcohol (CHEBI:15734) |
| rotiorinol C (CHEBI:68786) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (9R,9aR)-3-acetyl-9-hydroxy-6-[(1E,3E,5S)-7-hydroxy-3,5-dimethylhepta-1,3-dien-1-yl]-9a-methyl-9,9a-dihydro-2H-furo[3,2-g]isochromen-2-one |
| Synonym | Source |
|---|---|
| 6-acetyl-3-(3,5-dimethyl-1E,3E-heptadien-7-ol)-9R-hydroxy-8a(R)-methyl-7H-furo[2,3-g]-2-benzopyran-7-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15840538 | Reaxys |
| Citations |
|---|