EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38O7 |
| Net Charge | 0 |
| Average Mass | 534.649 |
| Monoisotopic Mass | 534.26175 |
| SMILES | CCC(C)CC(C)/C=C(C)/C=C/C(=O)C1=C2C3=COC([C@H]4C(=O)C[C@H](O)C[C@@H]4C)=CC3=CC(=O)[C@@]2(C)OC1=O |
| InChI | InChI=1S/C32H38O7/c1-7-17(2)10-19(4)11-18(3)8-9-24(34)29-30-23-16-38-26(28-20(5)12-22(33)15-25(28)35)13-21(23)14-27(36)32(30,6)39-31(29)37/h8-9,11,13-14,16-17,19-20,22,28,33H,7,10,12,15H2,1-6H3/b9-8+,18-11+/t17?,19?,20-,22+,28+,32+/m0/s1 |
| InChIKey | FERMTFXLLHKKDC-SBRYHICJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium longirostre (ncbitaxon:669026) | |||
| - | PubMed (22004007) | ||
| - | PubMed (22004007) | Ethyl acetate extract of dried fungal biomass |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| longirostrerone D (CHEBI:68774) has role Chaetomium metabolite (CHEBI:76960) |
| longirostrerone D (CHEBI:68774) has role antineoplastic agent (CHEBI:35610) |
| longirostrerone D (CHEBI:68774) is a azaphilone (CHEBI:50941) |
| longirostrerone D (CHEBI:68774) is a enone (CHEBI:51689) |
| longirostrerone D (CHEBI:68774) is a organic heterotricyclic compound (CHEBI:26979) |
| longirostrerone D (CHEBI:68774) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (6aS)-3-[(1S,2S,4R)-4-hydroxy-2-methyl-6-oxocyclohexyl]-6a-methyl-9-[(2E,4E)-4,6,8-trimethyldeca-2,4-dienoyl]-6H-furo[2,3-h]isochromene-6,8(6aH)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22123576 | Reaxys |
| Citations |
|---|