EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35NO6 |
| Net Charge | 0 |
| Average Mass | 445.556 |
| Monoisotopic Mass | 445.24644 |
| SMILES | [H][C@]12[C@H](C)C[C@H](C)C[C@]1([H])C=C[C@]([H])(/C(C)=C/C)[C@@H]2/C(O)=C1/C(=O)N[C@@H](C[C@](C)(O)C(=O)O)C1=O |
| InChI | InChI=1S/C25H35NO6/c1-6-13(3)16-8-7-15-10-12(2)9-14(4)18(15)19(16)22(28)20-21(27)17(26-23(20)29)11-25(5,32)24(30)31/h6-8,12,14-19,28,32H,9-11H2,1-5H3,(H,26,29)(H,30,31)/b13-6+,22-20-/t12-,14+,15-,16+,17-,18-,19-,25-/m0/s1 |
| InChIKey | AVZATKWNGXCSDN-IIRHHVPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (16872138) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. chemokine receptor 5 antagonist An antogonist that blocks chemokine receptor 5 (CCR5). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sch 210972 (CHEBI:68749) has role Chaetomium metabolite (CHEBI:76960) |
| sch 210972 (CHEBI:68749) has role chemokine receptor 5 antagonist (CHEBI:63673) |
| sch 210972 (CHEBI:68749) is a carbobicyclic compound (CHEBI:36785) |
| sch 210972 (CHEBI:68749) is a enol (CHEBI:33823) |
| sch 210972 (CHEBI:68749) is a monocarboxylic acid (CHEBI:25384) |
| sch 210972 (CHEBI:68749) is a octahydronaphthalenes (CHEBI:138397) |
| sch 210972 (CHEBI:68749) is a pyrrolidin-2-ones (CHEBI:74223) |
| sch 210972 (CHEBI:68749) is conjugate acid of sch 210972(2−) (CHEBI:167897) |
| Incoming Relation(s) |
| sch 213766 (CHEBI:66178) has functional parent sch 210972 (CHEBI:68749) |
| sch 210972(2−) (CHEBI:167897) is conjugate base of sch 210972 (CHEBI:68749) |
| IUPAC Name |
|---|
| (2S)-3-{(2S,4Z)-4-[{(1R,2S,4aR,6S,8R,8aS)-2-[(2E)-but-2-en-2-yl]-6,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl}(hydroxy)methylidene]-3,5-dioxopyrrolidin-2-yl}-2-hydroxy-2-methylpropanoic acid |
| Synonym | Source |
|---|---|
| sch210972 | ChEBI |
| Citations |
|---|