EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37NO6 |
| Net Charge | 0 |
| Average Mass | 459.583 |
| Monoisotopic Mass | 459.26209 |
| SMILES | [H][C@]12[C@H](/C(O)=C3/C(=O)N[C@H](C[C@@](C)(O)C(=O)OC)C3=O)[C@]([H])(/C(C)=C/C)C=C[C@]1([H])C[C@H](C)C[C@]2([H])C |
| InChI | InChI=1S/C26H37NO6/c1-7-14(3)17-9-8-16-11-13(2)10-15(4)19(16)20(17)23(29)21-22(28)18(27-24(21)30)12-26(5,32)25(31)33-6/h7-9,13,15-20,29,32H,10-12H2,1-6H3,(H,27,30)/b14-7+,23-21-/t13-,15+,16-,17+,18-,19-,20-,26-/m1/s1 |
| InChIKey | ITWQKCOXYYEWRZ-VOHDXAEZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | |||
| - | PubMed (17827664) | ||
| - | PubMed (17827664) |
| Roles Classification |
|---|
| Biological Roles: | chemokine receptor 5 antagonist An antogonist that blocks chemokine receptor 5 (CCR5). Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sch 213766 (CHEBI:66178) has functional parent sch 210972 (CHEBI:68749) |
| sch 213766 (CHEBI:66178) has role Chaetomium metabolite (CHEBI:76960) |
| sch 213766 (CHEBI:66178) has role chemokine receptor 5 antagonist (CHEBI:63673) |
| sch 213766 (CHEBI:66178) is a carbobicyclic compound (CHEBI:36785) |
| sch 213766 (CHEBI:66178) is a carboxylic ester (CHEBI:33308) |
| sch 213766 (CHEBI:66178) is a enol (CHEBI:33823) |
| sch 213766 (CHEBI:66178) is a octahydronaphthalenes (CHEBI:138397) |
| sch 213766 (CHEBI:66178) is a pyrrolidin-2-ones (CHEBI:74223) |
| sch 213766 (CHEBI:66178) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| methyl (2R)-3-{(2R,4Z)-4-[{(1S,2R,4aR,6R,8S,8aR)-2-[(2E)-but-2-en-2-yl]-6,8-dimethyldecahydronaphthalen-1-yl}(hydroxy)methylidene]-3,5-dioxopyrrolidin-2-yl}-2-hydroxy-2-methylpropanoate |
| Citations |
|---|