EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27ClO6 |
| Net Charge | 0 |
| Average Mass | 434.916 |
| Monoisotopic Mass | 434.14962 |
| SMILES | [H][C@]12C3=COC(/C=C/[C@@H](C)CC)=CC3=C(Cl)C(=O)[C@@]1(C)O[C@]1(O)[C@H](C)[C@@H](C)OC(=O)[C@]21[H] |
| InChI | InChI=1S/C23H27ClO6/c1-6-11(2)7-8-14-9-15-16(10-28-14)17-18-21(26)29-13(4)12(3)23(18,27)30-22(17,5)20(25)19(15)24/h7-13,17-18,27H,6H2,1-5H3/b8-7+/t11-,12+,13+,17+,18-,22-,23+/m0/s1 |
| InChIKey | VFAOIGZBHFMFIU-XSKLMDGHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (19246197) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetomugilin D (CHEBI:68730) has role Chaetomium metabolite (CHEBI:76960) |
| chaetomugilin D (CHEBI:68730) is a azaphilone (CHEBI:50941) |
| chaetomugilin D (CHEBI:68730) is a enone (CHEBI:51689) |
| chaetomugilin D (CHEBI:68730) is a organic heterotetracyclic compound (CHEBI:38163) |
| chaetomugilin D (CHEBI:68730) is a organochlorine compound (CHEBI:36683) |
| chaetomugilin D (CHEBI:68730) is a tertiary alcohol (CHEBI:26878) |
| chaetomugilin D (CHEBI:68730) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (6aS,7aR,8R,9R,11aR,11bS)-5-chloro-7a-hydroxy-6a,8,9-trimethyl-3-[(1E,3S)-3-methylpent-1-en-1-yl]-6a,7a,8,9,11a,11b-hexahydro-6H,11H-pyrano[3',4':4,5]furo[2,3-h]isochromene-6,11-dione |
| Manual Xrefs | Databases |
|---|---|
| 24705878 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19646845 | Reaxys |
| Citations |
|---|