EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27ClO4 |
| Net Charge | 0 |
| Average Mass | 390.907 |
| Monoisotopic Mass | 390.15979 |
| SMILES | CC[C@H](C)/C=C(C)/C=C/C1=CC2=C(Cl)C(=O)[C@](C)(O)[C@@H](CC(C)=O)C2=CO1 |
| InChI | InChI=1S/C22H27ClO4/c1-6-13(2)9-14(3)7-8-16-11-17-18(12-27-16)19(10-15(4)24)22(5,26)21(25)20(17)23/h7-9,11-13,19,26H,6,10H2,1-5H3/b8-7+,14-9+/t13-,19-,22+/m0/s1 |
| InChIKey | QEPMTPAOVMUVBT-NJCRSHSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium cupreum (ncbitaxon:155874) | - | PubMed (16792406) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epi-isochromophilone II (CHEBI:68700) has role Chaetomium metabolite (CHEBI:76960) |
| epi-isochromophilone II (CHEBI:68700) has role antifungal agent (CHEBI:35718) |
| epi-isochromophilone II (CHEBI:68700) is a azaphilone (CHEBI:50941) |
| epi-isochromophilone II (CHEBI:68700) is a enone (CHEBI:51689) |
| epi-isochromophilone II (CHEBI:68700) is a methyl ketone (CHEBI:51867) |
| epi-isochromophilone II (CHEBI:68700) is a organochlorine compound (CHEBI:36683) |
| epi-isochromophilone II (CHEBI:68700) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (7R,8S)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dien-1-yl]-7-hydroxy-7-methyl-8-(2-oxopropyl)-7,8-dihydro-6H-isochromen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15840533 | Reaxys |
| Citations |
|---|