EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | CCSCCC(N)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9) |
| InChIKey | GGLZPLKKBSSKCX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-ethylhomocysteine (CHEBI:68662) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| S-ethylhomocysteine (CHEBI:68662) is a organic sulfide (CHEBI:16385) |
| Incoming Relation(s) |
| D-ethionine (CHEBI:68663) is a S-ethylhomocysteine (CHEBI:68662) |
| L-ethionine (CHEBI:4886) is a S-ethylhomocysteine (CHEBI:68662) |
| IUPAC Name |
|---|
| S-ethylhomocysteine |
| Synonyms | Source |
|---|---|
| 2-amino-4-(ethylsulfanyl)butanoic acid | IUPAC |
| ethionine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722529 | Reaxys |
| CAS:67-21-0 | ChemIDplus |
| Citations |
|---|